On Target PLP_SARS 0.1626506/CHEMBL358279
For the given ligand Penciclovir, we have found in our database that, being scored 0.1626506, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| Penciclovir (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| Nc2nc(=O)c1ncn(CCC(CO)CO)c1[nH]2 | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 0000000a 00801800 00080000 00000600 00180040 0000c040 0000b004 00000800 06400100 800000e0 0000800c 40011000 00009000 00c00000 00080080 100c000c 00000000 00008000 09400000 00200001 80000100 1c000050 21800840 00700014 00000000 80200000 60000000 00040000 00004008 00461000 c0080000 80000280 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |