On Target NS3_HCV1A 0.3909091/CHEMBL3696815
For the given ligand Idoxuridine, we have found in our database that, being scored 0.3909091, the most similar ligand is CHEMBL3696815. Check out the elaboration below.
| Idoxuridine (Given Ligand) | CHEMBL3696815 (Similar Ligand) |
|---|---|
| O=c2[nH]c(=O)n([C@H]1C[C@H](O)[C@@H](CO)O1)cc2I | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@](C)(N)C1O)Oc1ccccc1 |
|
|
|
|
|
|
| 00000002 01400000 00200400 82030600 00180060 00004140 00000402 04000000 06000100 818000b0 0c00000c 40018000 00009280 03c80110 00a81080 001c800c 00200000 00008000 09c00100 00001001 800a00a0 10000010 25800041 08300010 10050400 c0000002 20000200 10040060 00004200 01460000 40280010 00000080 | 00200002 01540108 30000310 c9090f40 40180074 00084140 0202d401 80000820 0d004101 818008f4 0400100c 4845b16c 00009002 03ca0130 00289880 009d8a8c 002a0030 00000001 29c60000 00225043 a0080020 3e000a10 27800041 08600810 18000400 40002002 0f001200 10038060 02001289 01460034 55680000 201390c4 |