On Target PR_HIV1 0.1826923/CHEMBL3645129
For the given ligand Nevirapine, we have found in our database that, being scored 0.1826923, the most similar ligand is CHEMBL3645129. Check out the elaboration below.
| Nevirapine (Given Ligand) | CHEMBL3645129 (Similar Ligand) |
|---|---|
| Cc1ccnc3c1[nH]c(=O)c2cccnc2n3C4CC4 | CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OC1CC2OCO[C@@H]2C1)S(=O)(=O)c1ccc(CO)cc1 |
|
|
|
|
|
|
| 0200002a 00800800 00084100 00040610 000c1040 0000c040 00008000 00000000 06400100 c00000e0 0d00000c 40010000 80009800 01e00000 003400c0 000c0004 08000000 0280c000 00600000 00000000 c0000000 18008070 21800041 80100414 00040000 c0000000 08008000 00040000 00000000 00460000 c00c0000 000004a0 | 00000010 01c05400 01100102 01b10700 00280088 0002c004 00000800 a8000004 00740b00 014809e0 08302000 60018000 00008002 02200101 80e80000 003a0008 10822000 02080000 11408800 01007603 80000100 18380cb0 07100040 d9500058 02000000 8000100e 00000000 3420002c 04000600 2106001b c0a00000 00012670 |