On Target PLP_SARS 0.22023809/CHEMBL225515
For the given ligand Nevirapine, we have found in our database that, being scored 0.22023809, the most similar ligand is CHEMBL225515. Check out the elaboration below.
| Nevirapine (Given Ligand) | CHEMBL225515 (Similar Ligand) |
|---|---|
| Cc1ccnc3c1[nH]c(=O)c2cccnc2n3C4CC4 | O=C(Oc1cncc(Cl)c1)c1cc2ccccc2[nH]1 |
|
|
|
|
|
|
| 0200002a 00800800 00084100 00040610 000c1040 0000c040 00008000 00000000 06400100 c00000e0 0d00000c 40010000 80009800 01e00000 003400c0 000c0004 08000000 0280c000 00600000 00000000 c0000000 18008070 21800041 80100414 00040000 c0000000 08008000 00040000 00000000 00460000 c00c0000 000004a0 | 04008002 00000808 62024108 10010200 00041020 04004044 80080000 01200000 00000300 00000840 00080004 40048800 0680880c 08510002 01030042 020c000c 04028000 02802004 00200008 00020000 40000000 08068b68 b0802002 80c09104 00002c00 80182200 00000200 00000000 00000204 00020001 c0040200 10020000 |