On Target NS3_HCV1A 0.4861111/CHEMBL3976363
For the given ligand Ombitasvir, we have found in our database that, being scored 0.4861111, the most similar ligand is CHEMBL3976363. Check out the elaboration below.
| Ombitasvir (Given Ligand) | CHEMBL3976363 (Similar Ligand) |
|---|---|
| COC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)Nc6ccc([C@@H]4CC[C@@H](c3ccc(NC(=O)[C@@H]2CCCN2C(=O)[C@@H](NC(=O)OC)C(C)C)cc3)N4c5ccc(C(C)(C)C)cc5)cc6)C(C)C | CC(C)c1ccc2c(Nc3cc(C(=O)Nc4ccc(NC(=O)C5CCCN5C(=O)OCc5ccccc5)cc4)ccc3Sc3ccc(N)cc3)ncnc2n1 |
|
|
|
|
|
|
| 00014002 01003800 00100122 c4010600 20000000 0001a010 00000000 22001008 00900a00 00080ac0 08380004 4001f000 0e008812 0030a001 80020440 00120008 00062000 02080000 08002010 00000201 40100100 38048e30 20012003 0250001a 00000000 c0000002 00000000 900000a0 08008302 00060003 a0044000 00002600 | 1101400a 01c03a00 001a4120 1c190600 24040020 0801e010 00009010 02001808 10802300 00080ad0 08389004 6081f800 0e008812 00912000 80020040 1a1e000e 04061000 72084401 0860089a 12200201 c1100000 380e8e70 20816041 8258001f 00044000 80002202 022080d0 90a000a0 2840830c 01460003 e004c000 200106e0 |