On Target NS3_HCV1B 0.3592233/CHEMBL1170417
For the given ligand Ledipasvir, we have found in our database that, being scored 0.3592233, the most similar ligand is CHEMBL1170417. Check out the elaboration below.
| Ledipasvir (Given Ligand) | CHEMBL1170417 (Similar Ligand) |
|---|---|
| COC(=O)N[C@H](C(=O)N2CC1(CC1)C[C@H]2c%10nc(c9ccc8c7ccc(c6ccc5[nH]c([C@@H]4[C@H]3CC[C@H](C3)N4C(=O)[C@@H](NC(=O)OC)C(C)C)nc5c6)cc7C(F)(F)c8c9)c[nH]%10)C(C)C | C=Cc1cc([C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C(=O)N[C@@H](CCC)C(=O)NS(=O)(=O)c2ccccc2C=C)ccc1Oc1cc(-c2ccccc2)nc2cc(OC)ccc12 |
|
|
|
|
|
|
| 0000a00a 01003801 00100d00 94050e10 00040061 1011c01a 01400400 21082049 00800300 000808d0 09218004 7081ba02 0e008082 0970a000 20020040 821e010c 00028000 06083026 04202018 50080a1b 44300008 38070e30 31806011 02500038 00940001 a0080082 00000248 d00010e1 0a414284 01e60803 e01248a0 200066a0 | 08012092 41c03008 21104108 15b10600 002c1021 00018008 96060080 22081408 80800284 1049a8c0 08202004 6001b000 0f008802 0040a001 c1720441 025ea00c 020220c0 02082004 04682810 80467e01 c0400000 38248e18 30800003 bb400038 02002000 c0000006 88322048 9020406c 0c404784 20260403 a4067c02 00252670 |