On Target PR_HIV1 0.23783784/CHEMBL494500
For the given ligand Famciclovir, we have found in our database that, being scored 0.23783784, the most similar ligand is CHEMBL494500. Check out the elaboration below.
| Famciclovir (Given Ligand) | CHEMBL494500 (Similar Ligand) |
|---|---|
| CC(=O)OCC(CCn2cnc1cnc(N)nc12)COC(C)=O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CCCOCC2)cc1 |
|
|
|
|
|
|
| 0000000a 00801800 00080100 00010700 00180040 0000c000 0000a000 00000800 00400100 010000c0 0000800c 40019000 00009000 00800000 00080080 100c100c 00020000 00000000 09400000 00200001 80000020 1c000a50 21800840 00400014 00000400 00000000 00000200 00000000 00000208 0046100a c0080000 00000080 | 00000050 01c05408 2110010a 01b10700 002810c0 00028000 02000000 a0000004 00540a00 014809e0 08342000 60018000 00008002 00a00101 81e80001 001a1008 10822000 02080000 11402800 01027603 80000120 18280c90 03100040 d9500058 02000400 8000100e 00800000 1020008c 04000600 2006001b 80000000 00012670 |