On Target PR_HIV1 0.24429968/CHEMBL450294
For the given ligand Elbasvir, we have found in our database that, being scored 0.24429968, the most similar ligand is CHEMBL450294. Check out the elaboration below.
| Elbasvir (Given Ligand) | CHEMBL450294 (Similar Ligand) |
|---|---|
| COC(=O)N[C@H](C(=O)N1CCC[C@H]1c9nc(c2ccc4c(c2)O[C@@H](c3ccccc3)n8c4cc7cc(c6c[nH]c([C@@H]5CCCN5C(=O)[C@@H](NC(=O)OC)C(C)C)n6)ccc78)c[nH]9)C(C)C | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCN(C)CCOC2)cc1 |
|
|
|
|
|
|
| 0401e00a 41003208 20100d08 14810e12 20041061 0211c01a 03400400 20083049 84900340 500008d0 80258004 4001b800 0e808882 08712080 01021061 821e210c 00228080 060aa026 04280018 54423a07 40300000 38078e38 b1802001 83d0d019 00144001 c0092002 30000248 100010e8 0c414304 10e60c49 e0145ea0 20002240 | 00000010 01c05409 2110050a 81b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e81009 001b0008 10022000 02080000 01400800 01027603 80000120 18280c90 17100040 d9500058 12000400 8000000e 00800000 102000ed 04000600 20060013 80000000 00012670 |