On Target RT_HIV1 0.34402332/CHEMBL4109767
For the given ligand Elbasvir, we have found in our database that, being scored 0.34402332, the most similar ligand is CHEMBL4109767. Check out the elaboration below.
| Elbasvir (Given Ligand) | CHEMBL4109767 (Similar Ligand) |
|---|---|
| COC(=O)N[C@H](C(=O)N1CCC[C@H]1c9nc(c2ccc4c(c2)O[C@@H](c3ccccc3)n8c4cc7cc(c6c[nH]c([C@@H]5CCCN5C(=O)[C@@H](NC(=O)OC)C(C)C)n6)ccc78)c[nH]9)C(C)C | COC(=O)N[C@H](C(=O)NCc1ccc([C@@H](CO)N(Cc2cc3cccnc3[nH]2)S(=O)(=O)c2ccc(N)cc2)s1)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 0401e00a 41003208 20100d08 14810e12 20041061 0211c01a 03400400 20083049 84900340 500008d0 80258004 4001b800 0e808882 08712080 01021061 821e210c 00228080 060aa026 04280018 54423a07 40300000 38078e38 b1802001 83d0d019 00144001 c0092002 30000248 100010e8 0c414304 10e60c49 e0145ea0 20002240 | 0001001a 0080b200 03184100 15b10e01 100c00f0 0013c000 04000081 2b00700f 00c60b00 004938c0 09b12204 e000b880 8c008812 00d02021 b0262440 021e030c 18423000 0219000e 82700018 0000620d c0001900 78288eb0 23900000 cb400158 42100800 e4010406 40300800 d000206c 0c600784 2046000f e0044200 00c147e0 |