On Target NP_HCoV-OC43 0.1902834/CHEMBL3233481
For the given ligand Elbasvir, we have found in our database that, being scored 0.1902834, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Elbasvir (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| COC(=O)N[C@H](C(=O)N1CCC[C@H]1c9nc(c2ccc4c(c2)O[C@@H](c3ccccc3)n8c4cc7cc(c6c[nH]c([C@@H]5CCCN5C(=O)[C@@H](NC(=O)OC)C(C)C)n6)ccc78)c[nH]9)C(C)C | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 0401e00a 41003208 20100d08 14810e12 20041061 0211c01a 03400400 20083049 84900340 500008d0 80258004 4001b800 0e808882 08712080 01021061 821e210c 00228080 060aa026 04280018 54423a07 40300000 38078e38 b1802001 83d0d019 00144001 c0092002 30000248 100010e8 0c414304 10e60c49 e0145ea0 20002240 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |