On Target NS3_HCV1A 0.35357141/CHEMBL3913754
For the given ligand Fedratinib, we have found in our database that, being scored 0.35357141, the most similar ligand is CHEMBL3913754. Check out the elaboration below.
| Fedratinib (Given Ligand) | CHEMBL3913754 (Similar Ligand) |
|---|---|
| Cc3cnc(Nc2ccc(OCCN1CCCC1)cc2)nc3Nc4cccc(S(=O)(=O)NC(C)(C)C)c4 | COc1ccc(Sc2ccc(C#Cc3ccc(-c4c[nH]c([C@@H]5CCCN5C(=O)[C@@H]5CCCO5)n4)cc3)cc2Nc2ncnc3nc(C(C)C)ccc23)cc1 |
|
|
|
|
|
|
| 04002012 00800008 21100088 09b80612 02081288 00024010 0200a010 200008c8 00002100 000008c0 00302004 60009000 04800022 00000001 812a1941 000c020c 10042000 12004000 0840000a 50a26201 c0080002 1c042000 32804840 08400018 02040000 00000004 02040800 100110cd 00008608 20660804 43000000 000102e0 | 1001821a 01825a08 201a4d08 98190e10 044c30e0 0010601a 03409010 20082841 10002100 000808d0 08319004 6081d800 060088a3 09910000 010a1449 9a0c010e 14069000 f6006022 0c60040a 52220a11 c1200020 18858660 33806041 8258001f 10144405 80080200 02a082d8 100010c1 0041c20c 01e60803 c00088a0 200126e0 |