On Target NS3_HCV1A 0.29767442/CHEMBL4110202
For the given ligand Ruxolitinib, we have found in our database that, being scored 0.29767442, the most similar ligand is CHEMBL4110202. Check out the elaboration below.
| Ruxolitinib (Given Ligand) | CHEMBL4110202 (Similar Ligand) |
|---|---|
| N#CC[C@H](C1CCCC1)n4cc(c2ncnc3[nH]ccc23)cn4 | CC[C@@H](N)c1ccc(Cl)c(C(=O)c2ccc(-n3cccn3)nc2)c1F |
|
|
|
|
|
|
| 00010006 41810808 20080180 00840610 20080000 00006008 00000000 00100000 00004300 00000080 0000000c 60010800 82001c00 00900000 00020080 880c000c 00420040 82402004 04682000 00223003 c0000000 18038070 21802c41 02500114 00010003 80000000 00000000 10000040 0040000c 014e8001 c00a0200 400004a0 | 080080c6 00804a08 20104180 c2050610 400c5201 00004010 20002400 01001000 00408b00 00090ed0 09120004 4000aa00 82008864 08001004 00000100 080c000c 03018200 03800004 01600400 00220001 c1000520 1c078720 21800802 9360001c 00142000 a0000200 08040080 50800981 04400088 0046800a c4040000 80024ea0 |