On Target NS3_HCV1B 0.16666667/CHEMBL3125634
For the given ligand Diclofenac, we have found in our database that, being scored 0.16666667, the most similar ligand is CHEMBL3125634. Check out the elaboration below.
| Diclofenac (Given Ligand) | CHEMBL3125634 (Similar Ligand) |
|---|---|
| O=C(O)Cc1ccccc1Nc2c(Cl)cccc2Cl | CC(C)(C)NC(=O)Nc1nc(Cl)c(CCC2CCCCC2)n(CC(=O)Nc2ccccc2C(=O)NS(=O)(=O)c2ccc(C(F)(F)F)cc2)c1=O |
|
|
|
|
|
|
| 00008002 00000000 00000100 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 40009800 03008004 00000400 40060040 00080008 08048000 02000000 08000002 00000000 40000400 48000b00 21000000 00400010 00002000 80000600 02000008 00001080 00008008 00261002 00002000 20020400 | 1001403a 05801800 011815e2 51b50e30 0408014c 08016040 0500ac05 00883101 16e00a01 f0083af0 08b8a06c 6010b980 05088808 03700801 80a309c2 08140004 8e246080 46504000 8a402408 00a06003 e0120580 78238700 21026800 0860041e 17048802 c1000704 48000410 900010ac 08048c1e 20c61811 803e2000 600383e8 |