On Target NS3_HCV1B 0.23529412/CHEMBL1170417
For the given ligand Ruxolitinib, we have found in our database that, being scored 0.23529412, the most similar ligand is CHEMBL1170417. Check out the elaboration below.
| Ruxolitinib (Given Ligand) | CHEMBL1170417 (Similar Ligand) |
|---|---|
| N#CC[C@H](C1CCCC1)n4cc(c2ncnc3[nH]ccc23)cn4 | C=Cc1cc([C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C(=O)N[C@@H](CCC)C(=O)NS(=O)(=O)c2ccccc2C=C)ccc1Oc1cc(-c2ccccc2)nc2cc(OC)ccc12 |
|
|
|
|
|
|
| 00010006 41810808 20080180 00840610 20080000 00006008 00000000 00100000 00004300 00000080 0000000c 60010800 82001c00 00900000 00020080 880c000c 00420040 82402004 04682000 00223003 c0000000 18038070 21802c41 02500114 00010003 80000000 00000000 10000040 0040000c 014e8001 c00a0200 400004a0 | 08012092 41c03008 21104108 15b10600 002c1021 00018008 96060080 22081408 80800284 1049a8c0 08202004 6001b000 0f008802 0040a001 c1720441 025ea00c 020220c0 02082004 04682810 80467e01 c0400000 38248e18 30800003 bb400038 02002000 c0000006 88322048 9020406c 0c404784 20260403 a4067c02 00252670 |