On Target PA_INFA 0.24/CHEMBL2040569
For the given ligand Baricitinib, we have found in our database that, being scored 0.24, the most similar ligand is CHEMBL2040569. Check out the elaboration below.
| Baricitinib (Given Ligand) | CHEMBL2040569 (Similar Ligand) |
|---|---|
| CCS(=O)(=O)N4CC(CC#N)(n3cc(c1ncnc2[nH]ccc12)cn3)C4 | O=C(NCC1CC1)c1nc(-c2cnccn2)[nH]c(=O)c1O |
|
|
|
|
|
|
| 00010006 45810808 20180180 41b40e12 20080000 00006108 00000000 00102000 00204300 00400880 0020240c 64010800 82005c00 00940001 80420801 880c800c 00420040 82402004 04e80000 0c227003 c0000000 3c078070 21802cc1 32500134 0a010233 80000008 00100000 1000004c 0840000c 004e8011 c0080200 400106f0 | 00000202 00011808 40100100 10040e10 00000068 00124006 00c09800 28003405 16000100 401000a0 00290004 40040810 00008002 01708003 00820400 000c200c 08000068 1200b022 80c00000 10400201 00000000 50058600 21800040 4010011c 00044806 c0000680 28000030 90041004 0000410c 07660c01 e4008000 500002a0 |