On Target PR_HIV1 0.14948453/CHEMBL503401
For the given ligand Diclofenac, we have found in our database that, being scored 0.14948453, the most similar ligand is CHEMBL503401. Check out the elaboration below.
| Diclofenac (Given Ligand) | CHEMBL503401 (Similar Ligand) |
|---|---|
| O=C(O)Cc1ccccc1Nc2c(Cl)cccc2Cl | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCOCOCCOC2)cc1 |
|
|
|
|
|
|
| 00008002 00000000 00000100 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 40009800 03008004 00000400 40060040 00080008 08048000 02000000 08000002 00000000 40000400 48000b00 21000000 00400010 00002000 80000600 02000008 00001080 00008008 00261002 00002000 20020400 | 00000010 01c05409 2110050a 01b10600 000810c0 00028000 02002000 28000044 00742a00 014809e0 08302000 60018010 00008002 00200001 81e80001 003a8008 10022000 02080000 01400800 01027603 80100120 18280c90 07100040 d9500058 02000400 8000000e 00800000 342000ec 04000600 20060013 80000000 00012670 |