On Target RT_HIV1 0.2746479/CHEMBL4291913
For the given ligand Diclofenac, we have found in our database that, being scored 0.2746479, the most similar ligand is CHEMBL4291913. Check out the elaboration below.
| Diclofenac (Given Ligand) | CHEMBL4291913 (Similar Ligand) |
|---|---|
| O=C(O)Cc1ccccc1Nc2c(Cl)cccc2Cl | O=c1cc(Nc2cccc(-c3ccc(Cl)cc3)c2)[nH]c(=O)n1O |
|
|
|
|
|
|
| 00008002 00000000 00000100 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 40009800 03008004 00000400 40060040 00080008 08048000 02000000 08000002 00000000 40000400 48000b00 21000000 00400010 00002000 80000600 02000008 00001080 00008008 00261002 00002000 20020400 | 0100a002 00400000 00000108 4a090600 00000000 00004100 00009010 40000800 06002100 00000870 04300004 40049800 07008004 004000c0 002000c0 000c0414 00060040 1201c000 0c40000a 10200000 41802000 08060100 30804040 00d00000 00042000 c0080000 22040240 000400e0 0040c008 00460000 40000000 010200c0 |