On Target NS5B_HCV1A 0.34814814/CHEMBL3644907
For the given ligand Baricitinib, we have found in our database that, being scored 0.34814814, the most similar ligand is CHEMBL3644907. Check out the elaboration below.
| Baricitinib (Given Ligand) | CHEMBL3644907 (Similar Ligand) |
|---|---|
| CCS(=O)(=O)N4CC(CC#N)(n3cc(c1ncnc2[nH]ccc12)cn3)C4 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(c2ccc(-n3cccn3)cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 00010006 45810808 20180180 41b40e12 20080000 00006108 00000000 00102000 00204300 00400880 0020240c 64010800 82005c00 00940001 80420801 880c800c 00420040 82402004 04e80000 0c227003 c0000000 3c078070 21802cc1 32500134 0a010233 80000008 00100000 1000004c 0840000c 004e8011 c0080200 400106f0 | 00014086 0d403608 20100120 05390f00 20080000 0001c000 000a0004 a000340d 10800300 00538be8 01202404 5001b000 0e00f802 01042101 80420440 001e800c 02864010 00482000 48610850 00224a01 60100100 bc058e30 21820803 b304003a 02112000 00001002 00000000 902000ac 0c008200 8146009b e41c4000 810166f0 |