On Target NS5B_HCV1A 0.27419356/CHEMBL178973
For the given ligand Diclofenac, we have found in our database that, being scored 0.27419356, the most similar ligand is CHEMBL178973. Check out the elaboration below.
| Diclofenac (Given Ligand) | CHEMBL178973 (Similar Ligand) |
|---|---|
| O=C(O)Cc1ccccc1Nc2c(Cl)cccc2Cl | N#Cc1c(Cl)cc(Cl)cc1-c1cccc(C(=O)CC(=O)C(=O)O)c1 |
|
|
|
|
|
|
| 00008002 00000000 00000100 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 40009800 03008004 00000400 40060040 00080008 08048000 02000000 08000002 00000000 40000400 48000b00 21000000 00400010 00002000 80000600 02000008 00001080 00008008 00261002 00002000 20020400 | 0005a000 01000801 00000102 00810200 00080021 00000020 44000000 00000000 04100900 00880840 08100000 4001d800 06008004 00200408 a0000000 08082008 00420000 02001000 04c00008 00002001 00000100 08020b00 11000480 00400014 00002800 80000280 00040000 00000041 10004002 00020402 80000000 00420400 |