On Target NS5B_HCV1B 0.3537906/CHEMBL3645197
For the given ligand Baricitinib, we have found in our database that, being scored 0.3537906, the most similar ligand is CHEMBL3645197. Check out the elaboration below.
| Baricitinib (Given Ligand) | CHEMBL3645197 (Similar Ligand) |
|---|---|
| CCS(=O)(=O)N4CC(CC#N)(n3cc(c1ncnc2[nH]ccc12)cn3)C4 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)c3cnn(C)c3C)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00010006 45810808 20180180 41b40e12 20080000 00006108 00000000 00102000 00204300 00400880 0020240c 64010800 82005c00 00940001 80420801 880c800c 00420040 82402004 04e80000 0c227003 c0000000 3c078070 21802cc1 32500134 0a010233 80000008 00100000 1000004c 0840000c 004e8011 c0080200 400106f0 | 00004006 4580de08 20180982 51310e10 210c0000 0000c042 02044000 02001408 00100900 004909e0 0b312024 40118800 80009c33 01600201 808a0c40 000e200e 04268000 82000004 08680008 00225a03 e0120101 1c8b8e38 2080c800 9364001c 02104080 c0000048 00274080 8000108c 0c489104 0046005b e4048088 a81147e0 |