On Target NS5B_HCV1B 0.2868217/CHEMBL3645202
For the given ligand Ruxolitinib, we have found in our database that, being scored 0.2868217, the most similar ligand is CHEMBL3645202. Check out the elaboration below.
| Ruxolitinib (Given Ligand) | CHEMBL3645202 (Similar Ligand) |
|---|---|
| N#CC[C@H](C1CCCC1)n4cc(c2ncnc3[nH]ccc23)cn4 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)[C@H]3CCC[C@@H]3C(=O)OC)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00010006 41810808 20080180 00840610 20080000 00006008 00000000 00100000 00004300 00000080 0000000c 60010800 82001c00 00900000 00020080 880c000c 00420040 82402004 04682000 00223003 c0000000 18038070 21802c41 02500114 00010003 80000000 00000000 10000040 0040000c 014e8001 c00a0200 400004a0 | 00074006 0180de08 20180902 41310f00 211c0000 00004042 02040000 22001408 00100900 004909e0 09312024 40119800 84008c3b 01c00201 808a0040 000e200e 04a68000 02000104 08602008 00225203 e0100101 1c8b8e38 2180c800 9370001c 02104080 c0000048 00270280 9000108c 0c488306 0146005b c4068088 a8916fe0 |