On Target NA_INFB 0.22564103/CHEMBL195288
For the given ligand Fedratinib, we have found in our database that, being scored 0.22564103, the most similar ligand is CHEMBL195288. Check out the elaboration below.
| Fedratinib (Given Ligand) | CHEMBL195288 (Similar Ligand) |
|---|---|
| Cc3cnc(Nc2ccc(OCCN1CCCC1)cc2)nc3Nc4cccc(S(=O)(=O)NC(C)(C)C)c4 | CC(=O)N[C@@H](CC(C)C)[C@@H]1N[C@@H](C(=O)O)C[C@H]1c1ncc[nH]1 |
|
|
|
|
|
|
| 04002012 00800008 21100088 09b80612 02081288 00024010 0200a010 200008c8 00002100 000008c0 00302004 60009000 04800022 00000001 812a1941 000c020c 10042000 12004000 0840000a 50a26201 c0080002 1c042000 32804840 08400018 02040000 00000004 02040800 100110cd 00008608 20660804 43000000 000102e0 | 0401000a 01003000 00100420 14000400 000800c0 00000010 01000020 20000008 00000100 00000280 00208000 40013000 0600801a 01802001 811a0000 000c000c 10000000 0c000000 00402008 00000201 20100000 30040e30 23000001 02100018 00001000 00000000 00000000 10000180 08000004 00c60801 40024000 20802a00 |