On Target NA_INFB 0.21649484/CHEMBL362993
For the given ligand Ruxolitinib, we have found in our database that, being scored 0.21649484, the most similar ligand is CHEMBL362993. Check out the elaboration below.
| Ruxolitinib (Given Ligand) | CHEMBL362993 (Similar Ligand) |
|---|---|
| N#CC[C@H](C1CCCC1)n4cc(c2ncnc3[nH]ccc23)cn4 | CC(=O)N[C@@H](CC(C)C)[C@@H]1N[C@@H](C(=O)O)C[C@H]1c1cc[nH]n1 |
|
|
|
|
|
|
| 00010006 41810808 20080180 00840610 20080000 00006008 00000000 00100000 00004300 00000080 0000000c 60010800 82001c00 00900000 00020080 880c000c 00420040 82402004 04682000 00223003 c0000000 18038070 21802c41 02500114 00010003 80000000 00000000 10000040 0040000c 014e8001 c00a0200 400004a0 | 04010000 01003208 20100102 04000600 01080080 00000012 00000020 20000208 00000880 000c0080 00308000 400130c0 1e00801a 01a02001 81180000 000c200c 90000000 0e000000 00402000 00220241 00100000 32240e30 07800801 03100018 00002000 00000000 00120000 10000180 0c000006 0006c00b 00024000 00c02e20 |