On Target NSP15_SARS 0.16901408/CHEMBL221366
For the given ligand Diclofenac, we have found in our database that, being scored 0.16901408, the most similar ligand is CHEMBL221366. Check out the elaboration below.
| Diclofenac (Given Ligand) | CHEMBL221366 (Similar Ligand) |
|---|---|
| O=C(O)Cc1ccccc1Nc2c(Cl)cccc2Cl | O=C(Oc1cccnc1)c1cccs1 |
|
|
|
|
|
|
| 00008002 00000000 00000100 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 40009800 03008004 00000400 40060040 00080008 08048000 02000000 08000002 00000000 40000400 48000b00 21000000 00400010 00002000 80000600 02000008 00001080 00008008 00261002 00002000 20020400 | 04010042 04000808 60004108 20000200 00041040 04004084 00080080 00200000 00000100 00000040 00000204 40048080 00808814 08010000 01032000 060c000c 09030000 02002008 00200000 00020010 40002060 48008a80 30900000 10c09004 02002400 04082000 00000200 80000004 00000200 00020000 c0000000 10c10000 |