On Target NSP15_SARS 0.185567/CHEMBL2441741
For the given ligand Ruxolitinib, we have found in our database that, being scored 0.185567, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Ruxolitinib (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| N#CC[C@H](C1CCCC1)n4cc(c2ncnc3[nH]ccc23)cn4 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00010006 41810808 20080180 00840610 20080000 00006008 00000000 00100000 00004300 00000080 0000000c 60010800 82001c00 00900000 00020080 880c000c 00420040 82402004 04682000 00223003 c0000000 18038070 21802c41 02500114 00010003 80000000 00000000 10000040 0040000c 014e8001 c00a0200 400004a0 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |