On Target NS3_HCV1A 0.30088496/CHEMBL3645746
For the given ligand Laninamivir, we have found in our database that, being scored 0.30088496, the most similar ligand is CHEMBL3645746. Check out the elaboration below.
| Laninamivir (Given Ligand) | CHEMBL3645746 (Similar Ligand) |
|---|---|
| CO[C@H]([C@H](O)CO)[C@@H]1O/C(C(=O)O)=C\[C@H](NC(=N)N)[C@H]1NC(C)=O | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)CC1CCCCO1)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00000000 8904f200 00100101 84010d01 003c00c1 00200200 00080180 38802c48 01002600 011000ca 80200000 4001c000 8002b002 01892000 02001408 391b9008 30a10814 80000540 51c16010 00002201 20000020 70152fb0 17008080 0a10001c 00021403 88008c00 40c04200 90000121 0800c250 00040401 ac0e0000 00004a00 | 000100e0 09003000 06100100 05210500 800c0000 00200010 000a0000 20001408 10000000 0010c188 00602000 4001b000 1601801a 01882011 a0400400 00081008 04204000 00000000 46c12000 00004201 00000020 30040630 01000083 32900038 00000401 00000000 00000000 90000010 08000200 c0040081 64024004 00012260 |