On Target NS3_HCV1B 0.31474105/CHEMBL3954962
For the given ligand Laninamivir, we have found in our database that, being scored 0.31474105, the most similar ligand is CHEMBL3954962. Check out the elaboration below.
| Laninamivir (Given Ligand) | CHEMBL3954962 (Similar Ligand) |
|---|---|
| CO[C@H]([C@H](O)CO)[C@@H]1O/C(C(=O)O)=C\[C@H](NC(=N)N)[C@H]1NC(C)=O | C=CC(=O)NC[C@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C1CCCCC1)C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C(=O)N[C@@H](CCC)C(OC(=O)C(F)(F)F)C(=O)NC1CC1 |
|
|
|
|
|
|
| 00000000 8904f200 00100101 84010d01 003c00c1 00200200 00080180 38802c48 01002600 011000ca 80200000 4001c000 8002b002 01892000 02001408 391b9008 30a10814 80000540 51c16010 00002201 20000020 70152fb0 17008080 0a10001c 00021403 88008c00 40c04200 90000121 0800c250 00040401 ac0e0000 00004a00 | 10018002 01807400 00100b00 94010f10 000800c0 00100010 0000c00c 20003409 11000000 000101a0 01290000 4001f000 0e00801a 01112001 809a1408 000c110c 18860000 82000103 02402010 00001205 80000120 300f8e30 33004003 0250001c 00141400 00000000 08880000 90000005 08000204 01060813 a4024000 82002600 |