On Target NS5B_HCV1B 0.22257054/CHEMBL3645214
For the given ligand Laninamivir, we have found in our database that, being scored 0.22257054, the most similar ligand is CHEMBL3645214. Check out the elaboration below.
| Laninamivir (Given Ligand) | CHEMBL3645214 (Similar Ligand) |
|---|---|
| CO[C@H]([C@H](O)CO)[C@@H]1O/C(C(=O)O)=C\[C@H](NC(=N)N)[C@H]1NC(C)=O | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)C3CCOC3)S(C)(=O)=O)cc2nn1-c1ccc(Nc2ccc(F)cc2)cc1 |
|
|
|
|
|
|
| 00000000 8904f200 00100101 84010d01 003c00c1 00200200 00080180 38802c48 01002600 011000ca 80200000 4001c000 8002b002 01892000 02001408 391b9008 30a10814 80000540 51c16010 00002201 20000020 70152fb0 17008080 0a10001c 00021403 88008c00 40c04200 90000121 0800c250 00040401 ac0e0000 00004a00 | 00044006 00805e08 20180902 43390f00 211c0000 00204052 02040010 2200140c 00102900 004909e0 09312024 40119800 94008c23 01481201 808a0040 000e200e 04268000 02000104 08e0000a 00225203 e0100121 1c8f8e38 21800880 9360001c 02104481 c0000048 02270280 9000108d 0c488304 0046805b c4048080 a0116fe0 |