On Target NS5B_HCV1B 0.18691589/CHEMBL3645210
For the given ligand Captopril, we have found in our database that, being scored 0.18691589, the most similar ligand is CHEMBL3645210. Check out the elaboration below.
| Captopril (Given Ligand) | CHEMBL3645210 (Similar Ligand) |
|---|---|
| C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)C3CCC3)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00010000 01005000 00100000 00100400 00080080 00000010 00000000 20000000 00000000 00000080 00200000 40013000 06008012 01040000 80080000 00080008 10000000 00000000 00400000 00400201 40000000 10040e00 03000200 00100018 00000000 00000000 00000000 10000000 00000000 00040021 20004000 01012200 | 00014006 0180de08 20180902 41310e00 210c0000 00004042 02040000 22001408 00100900 004909e0 09312024 40119800 84008c33 01400211 808a0040 000e200e 04268000 02000004 08600008 00225203 e0100101 1c8b8e38 2080c800 9370001c 02104080 c0000048 00270080 9000108c 0c488104 0046005b c4048088 a81167e0 |