On Target NSP15_SARS 0.25405404/CHEMBL2441745
For the given ligand oseltamivir, we have found in our database that, being scored 0.25405404, the most similar ligand is CHEMBL2441745. Check out the elaboration below.
| oseltamivir (Given Ligand) | CHEMBL2441745 (Similar Ligand) |
|---|---|
| CCOC(=O)/C1=C/[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C(=O)NC(C)C |
|
|
|
|
|
|
| 00070040 09007000 00100000 80010700 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a24000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04200 90000001 0c000200 00040401 04020000 00000210 | 01030000 01403600 00100100 04010600 00000000 0001c010 00000000 2000000c 04e00b00 000a09e0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080401 00002898 00000201 00000100 382c0e38 00000003 83500018 00001800 80002002 00000000 10200020 0c000200 0006001b e0024000 00802600 |