On Target NS3_HCV1A 0.29385966/CHEMBL3645759
For the given ligand Fosinopril, we have found in our database that, being scored 0.29385966, the most similar ligand is CHEMBL3645759. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL3645759 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](OC)c1ccccc1)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 000100a0 09003000 06100100 05210600 00000080 00004010 000a0000 20001408 10000180 0018c9c8 08602000 4001f000 0701801a 01012013 e0581400 02080008 14004000 82000000 46012000 00004201 00000000 38240630 12000003 b3d00038 00000000 80002000 00000000 90000011 0c000200 c0060083 64026004 00012660 |