On Target NS3_HCV1B 0.24183007/CHEMBL297884
For the given ligand abacavir, we have found in our database that, being scored 0.24183007, the most similar ligand is CHEMBL297884. Check out the elaboration below.
| abacavir (Given Ligand) | CHEMBL297884 (Similar Ligand) |
|---|---|
| Nc4nc(NC1CC1)c3ncn([C@H]2/C=C\[C@@H](CO)C2)c3n4 | COc1ccc2c(O[C@@H]3C[C@H]4C(=O)N[C@]5(C(=O)O)C[C@H]5/C=C\CCCCC[C@H](NC(=O)OC5CCCC5)C(=O)N4C3)cc(-c3csc(NC(C)C)n3)nc2c1 |
|
|
|
|
|
|
| 0001001a 81801801 00181800 08080620 22180048 0000c010 0008a000 00100c02 10400100 001000c8 0020820c 41091000 04001000 01800000 000a0485 100c000c 20040000 00004140 08410000 80202001 80100000 1c040050 2180c844 00400014 00000002 00300000 00400400 800000c0 04020008 00461000 c4081000 000002c0 | 04072002 c9427008 a0104908 14810702 211c10a0 02118050 c6080100 b00a848a 10800300 2010c8ca 00202a04 5101b420 0e82881a 01502183 911a3441 021e200c 10a24000 120861c4 44e82818 12e63a01 40080000 3914aef8 f390c883 82510018 00a01081 8c101002 00e04240 90200465 0c00420c 850e2403 e4065800 04252a42 |