On Target RT_HIV1 0.43542436/CHEMBL4110612
For the given ligand Atazanavir, we have found in our database that, being scored 0.43542436, the most similar ligand is CHEMBL4110612. Check out the elaboration below.
| Atazanavir (Given Ligand) | CHEMBL4110612 (Similar Ligand) |
|---|---|
| COC(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)[C@@H](O)CN(Cc3ccc(c2ccccn2)cc3)NC(=O)[C@@H](NC(=O)OC)C(C)(C)C)C(C)(C)C | COC(=O)N[C@H](C(=O)NCc1ccc([C@@H](CO)N(CC2CC(F)(F)C2)S(=O)(=O)c2cccc(Cc3ccccn3)c2)s1)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 0000200e 09007400 00106142 14010600 000401a0 00018000 00010000 2208101c 03900b80 50080de8 0830801c 4001b000 8c008802 00202000 201a0480 021e000c 10020000 02082000 04700010 10400201 c0000100 38288e10 73814041 83500018 00000000 c0000002 10000040 90000060 0d004304 004e0413 a0044800 00042688 | 0001001a 09803200 03186100 15b10601 100c01e0 000b8000 04000081 2300500e 00c60b00 004918c0 0930a204 e081f880 8c008812 00002031 806e2480 021e038c 18423000 0219000d 00718018 0000660d c0001900 78288e90 23900000 db500058 42000800 e4010006 40000860 d000302c 0c200784 2406000f a0004000 20c107f0 |