On Target NS5B_HCV1A 0.28625953/CHEMBL3644939
For the given ligand abacavir, we have found in our database that, being scored 0.28625953, the most similar ligand is CHEMBL3644939. Check out the elaboration below.
| abacavir (Given Ligand) | CHEMBL3644939 (Similar Ligand) |
|---|---|
| Nc4nc(NC1CC1)c3ncn([C@H]2/C=C\[C@@H](CO)C2)c3n4 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(c2cc(Cl)nc(N3CCCCC3)n2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 0001001a 81801801 00181800 08080620 22180048 0000c010 0008a000 00100c02 10400100 001000c8 0020820c 41091000 04001000 01800000 000a0485 100c000c 20040000 00004140 08410000 80202001 80100000 1c040050 2180c844 00400014 00000002 00300000 00400400 800000c0 04020008 00461000 c4081000 000002c0 | 00038086 0d403403 00100120 0f390f00 22180008 0001c000 000aa004 a0103c89 10800300 20528ba8 00202424 7001b880 0e00f006 01042101 80420400 001e800c 02864010 00486010 40610850 00a05a01 20100500 b6050f10 21824843 3214003a 02112000 00001302 00080000 902000ec 08000218 81460893 e4187000 014322f0 |