On Target PLP_SARS 0.19711539/CHEMBL213543
For the given ligand abacavir, we have found in our database that, being scored 0.19711539, the most similar ligand is CHEMBL213543. Check out the elaboration below.
| abacavir (Given Ligand) | CHEMBL213543 (Similar Ligand) |
|---|---|
| Nc4nc(NC1CC1)c3ncn([C@H]2/C=C\[C@@H](CO)C2)c3n4 | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
|
|
|
|
|
|
| 0001001a 81801801 00181800 08080620 22180048 0000c010 0008a000 00100c02 10400100 001000c8 0020820c 41091000 04001000 01800000 000a0485 100c000c 20040000 00004140 08410000 80202001 80100000 1c040050 2180c844 00400014 00000002 00300000 00400400 800000c0 04020008 00461000 c4081000 000002c0 | 01030000 0140b000 00100100 04010600 00000000 0001c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 0e028002 00012001 80000400 021a0008 20020000 02080500 20012890 00001201 00002000 38040fb0 00008003 02500018 00001400 8800ac02 00484000 90200120 08000200 00060001 ec004000 02802210 |