On Target RDRP_SARS2 0.20382166/CHEMBL4065616
For the given ligand test, we have found in our database that, being scored 0.20382166, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| test (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| Nc2ccn([C@@H]1CS[C@H](CO)O1)c(=O)n2 | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 00000002 40400000 20000001 88180640 04080040 00006000 40009400 00000910 04000100 010040b0 0410900c 40059004 00009000 21dc0010 05a05080 001c100c 04240006 00200000 00402000 00201000 80080000 18000000 25800241 08600800 00030400 40000012 00000200 90003060 00000209 01460000 c0280000 060100c0 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |