On Target PA_INFA 0.491453/CHEMBL4593284
For the given ligand WIN, we have found in our database that, being scored 0.491453, the most similar ligand is CHEMBL4593284. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL4593284 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | COCCN1C[C@H](C(c2ccccc2)c2ccccc2)n2cc(OC)c(=O)c(O)c2C1=O |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 0000001b 00007e08 70104109 50010e00 100410b8 00120044 4c8c0000 23203401 02300800 801908c0 08390004 40058000 00009806 08500000 011a1c00 020c210c 10004000 02004002 08200000 00060201 40000181 382f8610 32802000 c350801c 08112440 e0000080 00e20060 d0060001 0c040384 0406001b a40c0000 40004600 |