On Target NS5B_HCV2A 0.26639345/CHEMBL4203791
For the given ligand WIN, we have found in our database that, being scored 0.26639345, the most similar ligand is CHEMBL4203791. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL4203791 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)Nc1ccc([C@@H]2CC[C@@H](c3ccc(NC(=O)[C@@H]4CCCN4C(=O)[C@@H](NC(=O)OC)C(C)C)cc3)N2c2ccc([Si](C)(C)C(C)(C)C)cc2)cc1)C(C)C |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 00014002 01003800 00500122 c4010600 20000000 0001a010 00000420 22001008 00980a20 00080ac0 08380004 4021f000 0e008812 0030a001 80020440 00120088 00062000 020c0000 88022090 08000201 40100100 38048e38 20052003 0250001a 00000000 e0000002 00000000 900000a0 08008382 00068003 a0044000 00006600 |