On Target RT_HIV1 0.047210302/CHEMBL4114220
For the given ligand CN(C)C(=N)/N=C(N)/N, we have found in our database that, being scored 0.047210302, the most similar ligand is CHEMBL4114220. Check out the elaboration below.
| CN(C)C(=N)/N=C(N)/N (Given Ligand) | CHEMBL4114220 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | COC(=O)N[C@H](C(=O)NCc1ccc([C@@H](CO)N(Cc2cnon2)S(=O)(=O)c2ccc(N)cc2)s1)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 0089009a 00803200 03180100 07b10e11 120800d0 00038000 04004081 2300700f 00c60b80 004978c0 09312224 e000b880 8c008812 00003029 80242460 001e120c 1a423200 0219000c 0870001c 0000620d c1001b20 7828ce90 23100000 eb400058 42000811 e4010007 c0300800 d00020ee 0c200784 2006000f a0004000 00c107e0 |