On Target NS5B_HCV1A 0.03968254/CHEMBL13256
For the given ligand m, we have found in our database that, being scored 0.03968254, the most similar ligand is CHEMBL13256. Check out the elaboration below.
| m (Given Ligand) | CHEMBL13256 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | CC[C@H](NC(=O)[C@H](CC1CCCCC1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)c1cnccn1)[C@@H](C)CC)C(=O)C(=O)NCC(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 10018002 01807400 00100800 14000c10 000000c0 00100000 0000c000 20003009 14000000 000101a0 01292000 40013000 0e00800a 00102003 808a0400 000c010c 18020000 02000003 02002010 00000201 80000000 300f8e10 23004003 02100018 00141000 00000000 08000000 90000004 08000004 00060811 a0024000 80002200 |