On Target NS5B_HCV1B 0.03862661/CHEMBL3645196
For the given ligand m, we have found in our database that, being scored 0.03862661, the most similar ligand is CHEMBL3645196. Check out the elaboration below.
| m (Given Ligand) | CHEMBL3645196 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)c3nonc3C)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 00886086 0080de08 20180902 53310e10 230c0000 0000c042 22044000 02003408 00140900 004969e0 09312024 40118800 80008c73 01601209 808a0460 000e300e 06268200 02000004 0c600008 00225203 e1120121 1c8b8e38 2180e800 b360001c 02104090 c0000049 00274080 8001108e 0c488104 0046005b e4048088 a81147e0 |