On Target CAPSD_HCV77 0.0625/CHEMBL3645767
For the given ligand m, we have found in our database that, being scored 0.0625, the most similar ligand is CHEMBL3645767. Check out the elaboration below.
| m (Given Ligand) | CHEMBL3645767 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)c1cnon1)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 0089a0a0 09003000 06100000 07200c10 02000000 00000010 200a4000 20003408 10040000 0011e188 00612020 40013000 0601805a 01003019 a0400420 00041004 06024200 02000000 46012000 00004201 01000020 30070e30 01002003 32900038 00000010 00000001 00000000 90000092 08000004 c0060081 e4024004 00012260 |