On Target DPM_HHV1K 0.114832535/CHEMBL479371
For the given ligand Y, we have found in our database that, being scored 0.114832535, the most similar ligand is CHEMBL479371. Check out the elaboration below.
| Y (Given Ligand) | CHEMBL479371 (Similar Ligand) |
|---|---|
| COC(=O)Cc1ccccc1 | CN(Cc1cc2c(=O)c(C(=O)NCc3ccc(Cl)cc3)cn(C)c2o1)C[C@@H](O)c1ccccn1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000040 00000000 00080840 08000000 40009000 01008000 00000000 40040000 00080008 08020000 02000000 04000000 00000000 00000000 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000200 00020002 00002000 00000400 | 1401818a 00a2d800 00184120 10014610 040416a3 80004000 00004400 42281200 020843e1 80080ad0 09208434 4081b802 c6009c6e 01600188 01020460 020c040c 1002e000 ca804004 02200080 08000200 c0000000 1a268f30 22a04002 a158001c 10843020 e0000002 0c940054 98040000 04402104 03860043 e0140000 a0020600 |