On Target PLP_SARS 0.21186441/CHEMBL358279
For the given ligand Y, we have found in our database that, being scored 0.21186441, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| Y (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| COC(=O)Cc1ccccc1 | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000040 00000000 00080840 08000000 40009000 01008000 00000000 40040000 00080008 08020000 02000000 04000000 00000000 00000000 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000200 00020002 00002000 00000400 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |