On Target NS5B_HCV2A 0.18571429/CHEMBL3127326
For the given ligand X, we have found in our database that, being scored 0.18571429, the most similar ligand is CHEMBL3127326. Check out the elaboration below.
| X (Given Ligand) | CHEMBL3127326 (Similar Ligand) |
|---|---|
| COC(=O)Cc1cccc(O)c1 | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)Nc1ccc([C@@H]2CC[C@@H](c3ccc(NC(=O)[C@@H]4CCCN4C(=O)[C@@H](NC(=O)OC)C(C)C)cc3)N2c2ccc(C(C)(C)C)cc2)cc1)C(C)C |
|
|
|
|
|
|
| 00000000 42000008 20000100 00010200 00000041 00000000 02000000 00000040 00000000 00080840 08000000 40009000 01008002 00000000 40040000 00080008 08020000 02000000 04000000 00020200 00000000 08000a00 01000000 00400010 00000000 80000000 00000000 00010000 00000200 00020002 00002000 00000400 | 00014002 01003800 00100122 c4010600 20000000 0001a010 00000000 22001008 00900a00 00080ac0 08380004 4001f000 0e008812 0030a001 80020440 00120008 00062000 02080000 08002010 00000201 40100100 38048e30 20012003 0250001a 00000000 c0000002 00000000 900000a0 08008302 00060003 a0044000 00002600 |