On Target NP_HCoV-OC43 0.09090909/CHEMBL3233481
For the given ligand X, we have found in our database that, being scored 0.09090909, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| X (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| COC(=O)Cc1cccc(O)c1 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00000000 42000008 20000100 00010200 00000041 00000000 02000000 00000040 00000000 00080840 08000000 40009000 01008002 00000000 40040000 00080008 08020000 02000000 04000000 00020200 00000000 08000a00 01000000 00400010 00000000 80000000 00000000 00010000 00000200 00020002 00002000 00000400 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |