On Target DPM_HHV1K 0.1908397/CHEMBL481172
For the given ligand mangefirine, we have found in our database that, being scored 0.1908397, the most similar ligand is CHEMBL481172. Check out the elaboration below.
| mangefirine (Given Ligand) | CHEMBL481172 (Similar Ligand) |
|---|---|
| O=c3c1cc(O)c(O)cc1oc4cc(O)c([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(O)c34 | CN(Cc1cc2c(=O)c(C(=O)NCc3ccc(Cl)cc3)cn(C)c2o1)C[C@@H](O)c1ccco1 |
|
|
|
|
|
|
| 00000001 01200008 a0080102 00010300 80280250 80004020 02000000 40000a00 02084900 41080840 081000a0 40008140 40008402 02a10088 00040000 020ab008 08000800 02000040 19402000 00820801 00000120 2a000028 05014040 08580010 08000450 80002005 00080090 08100020 00002202 01834802 40020000 02000400 | 1041818a 00a2d800 80184101 00014610 04041683 80004000 00004400 4a281200 020841e1 800808d0 01200434 4001b802 c6089c6e 01600188 00004460 000c040c 10026000 c200c004 02200080 08000200 c0000000 1a268f10 22a04000 a159001c 30842070 e0000402 0c940054 98040000 24402101 03860043 e0140000 80020600 |