On Target PR_HIV1 0.2522936/CHEMBL3645127
For the given ligand mangefirine, we have found in our database that, being scored 0.2522936, the most similar ligand is CHEMBL3645127. Check out the elaboration below.
| mangefirine (Given Ligand) | CHEMBL3645127 (Similar Ligand) |
|---|---|
| O=c3c1cc(O)c(O)cc1oc4cc(O)c([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(O)c34 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CC3OCCO[C@@H]3C2)cc1 |
|
|
|
|
|
|
| 00000001 01200008 a0080102 00010300 80280250 80004020 02000000 40000a00 02084900 41080840 081000a0 40008140 40008402 02a10088 00040000 020ab008 08000800 02000040 19402000 00820801 00000120 2a000028 05014040 08580010 08000450 80002005 00080090 08100020 00002202 01834802 40020000 02000400 | 00000010 01c05408 2110010a 01b10700 002810c0 00028000 02000000 a0000044 00542a00 014809e0 08302000 60018000 00008002 02200101 81e80001 001a9008 10822000 02080000 11400800 01027603 80000120 18280c90 07100040 d9500058 02000400 8000100e 00800000 102200ac 04000600 2106001b 80000000 00012670 |