On Target NS5B_HCV1A 0.25433525/CHEMBL446360
For the given ligand mangefirine, we have found in our database that, being scored 0.25433525, the most similar ligand is CHEMBL446360. Check out the elaboration below.
| mangefirine (Given Ligand) | CHEMBL446360 (Similar Ligand) |
|---|---|
| O=c3c1cc(O)c(O)cc1oc4cc(O)c([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(O)c34 | N#Cc1ccc(Br)cc1Oc1ccccc1C(=O)CC(=O)C(=O)O |
|
|
|
|
|
|
| 00000001 01200008 a0080102 00010300 80280250 80004020 02000000 40000a00 02084900 41080840 081000a0 40008140 40008402 02a10088 00040000 020ab008 08000800 02000040 19402000 00820801 00000120 2a000028 05014040 08580010 08000450 80002005 00080090 08100020 00002202 01834802 40020000 02000400 | 00054004 01008808 2000010a 00018200 00081020 00020002 06404000 00000201 04000904 00880840 0814000a 4000d040 04008012 00200000 01000001 00082008 00400000 02000000 00c02008 00020001 00400100 08020a00 01000400 00400414 00000800 c0000000 00120800 00200000 00000302 00064422 81020408 08400400 |