On Target CAPSD_HCV77 0.22875817/CHEMBL3932962
For the given ligand mangefirine, we have found in our database that, being scored 0.22875817, the most similar ligand is CHEMBL3932962. Check out the elaboration below.
| mangefirine (Given Ligand) | CHEMBL3932962 (Similar Ligand) |
|---|---|
| O=c3c1cc(O)c(O)cc1oc4cc(O)c([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(O)c34 | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(C)S(C)(=O)=O)c(-c3ccc4c(c3)-c3[nH]c5ccccc5c3C3(CCCC3)O4)cc12 |
|
|
|
|
|
|
| 00000001 01200008 a0080102 00010300 80280250 80004020 02000000 40000a00 02084900 41080840 081000a0 40008140 40008402 02a10088 00040000 020ab008 08000800 02000040 19402000 00820801 00000120 2a000028 05014040 08580010 08000450 80002005 00080090 08100020 00002202 01834802 40020000 02000400 | 0c41a002 01200809 2018090a 52b10712 0a8e1321 0a00c110 02252000 42aa3200 10474900 10480840 8c30a124 40108c00 ca808c13 00619881 f12a4c61 220e200c 00864001 2203b804 0e612602 10524023 402e0108 3a028e2e f1804020 80c85014 0884608c 80006001 3c420014 988010cd 0040e307 11068403 c0040a40 00010660 |